C42H43N3 — CID 129191079
2-[(2E,4E)-4-buta-1,3-dien-2-ylhepta-2,4,6-trien-3-yl]-4,6-bis[(3E,5E,6Z)-6-ethenyl-5-prop-2-enylidenenona-1,3,6,8-tetraen-4-yl]-1,3,5-triazine (PubChem CID 129191079) has the molecular formula C42H43N3 and a molecular weight of 589.83 g/mol. Its IUPAC name is 2-[(2E,4E)-4-buta-1,3-dien-2-ylhepta-2,4,6-trien-3-yl]-4,6-bis[(3E,5E,6Z)-6-ethenyl-5-prop-2-enylidenenona-1,3,6,8-tetraen-4-yl]-1,3,5-triazine.
| Compound Name | 2-[(2E,4E)-4-buta-1,3-dien-2-ylhepta-2,4,6-trien-3-yl]-4,6-bis[(3E,5E,6Z)-6-ethenyl-5-prop-2-enylidenenona-1,3,6,8-tetraen-4-yl]-1,3,5-triazine |
|---|---|
| PubChem CID | 129191079 |
| Molecular Formula | C42H43N3 |
| Molecular Weight | 589.83 g/mol |
| Exact Mass | 589.35 |
| IUPAC Name | 2-[(2E,4E)-4-buta-1,3-dien-2-ylhepta-2,4,6-trien-3-yl]-4,6-bis[(3E,5E,6Z)-6-ethenyl-5-prop-2-enylidenenona-1,3,6,8-tetraen-4-yl]-1,3,5-triazine |
| SMILES | C=C/C=C(C=C)\C(=C/C=C)C(=C\C=C)\c1nc(C(=C\C=C)/C(=C/C=C)C(/C=C)=C\C=C)nc(C(=C/C)/C(=C/C=C)C(=C)C=C)n1 |
| InChI | InChI=1S/C42H43N3/c1-13-24-32(21-9)36(27-16-4)38(29-18-6)41-43-40(34(23-11)35(26-15-3)31(12)20-8)44-42(45-41)39(30-19-7)37(28-17-5)33(22-10)25-14-2/h13-30H,1-10,12H2,11H3/b32-24-,33-25-,34-23+,35-26+,36-27+,37-28+,38-29+,39-30+ |
| InChIKey | NYPKZNMIZWBRGZ-ZFBJCYRESA-N |
| XLogP | 11.09 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.83 |
| LogP ≤ 5 | 11.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|