C24H50O — CID 129191195
2,5,9,10,10,14,15,15-octamethylhexadecan-5-ol (PubChem CID 129191195) has the molecular formula C24H50O and a molecular weight of 354.66 g/mol. Its IUPAC name is 2,5,9,10,10,14,15,15-octamethylhexadecan-5-ol.
| Compound Name | 2,5,9,10,10,14,15,15-octamethylhexadecan-5-ol |
|---|---|
| PubChem CID | 129191195 |
| Molecular Formula | C24H50O |
| Molecular Weight | 354.66 g/mol |
| Exact Mass | 354.39 |
| IUPAC Name | 2,5,9,10,10,14,15,15-octamethylhexadecan-5-ol |
| SMILES | CC(C)CCC(C)(O)CCCC(C)C(C)(C)CCCC(C)C(C)(C)C |
| InChI | InChI=1S/C24H50O/c1-19(2)15-18-24(10,25)17-12-14-21(4)23(8,9)16-11-13-20(3)22(5,6)7/h19-21,25H,11-18H2,1-10H3 |
| InChIKey | GGPMFRNGEWJUTJ-UHFFFAOYSA-N |
| XLogP | 7.86 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.66 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |