About 4-tert-butyl-N,N-dimethyl-3,4-dihydropyridin-2-amine
4-tert-butyl-N,N-dimethyl-3,4-dihydropyridin-2-amine (PubChem CID 129191316) has the molecular formula C11H20N2
and a molecular weight of 180.29 g/mol. Its IUPAC name is 4-tert-butyl-N,N-dimethyl-3,4-dihydropyridin-2-amine.
Molecular Properties
| Compound Name | 4-tert-butyl-N,N-dimethyl-3,4-dihydropyridin-2-amine |
| PubChem CID | 129191316 |
| Molecular Formula | C11H20N2 |
| Molecular Weight | 180.29 g/mol |
| Exact Mass | 180.16 |
| IUPAC Name | 4-tert-butyl-N,N-dimethyl-3,4-dihydropyridin-2-amine |
| SMILES | CN(C)C1=NC=CC(C(C)(C)C)C1 |
| InChI | InChI=1S/C11H20N2/c1-11(2,3)9-6-7-12-10(8-9)13(4)5/h6-7,9H,8H2,1-5H3 |
| InChIKey | LLJXAYLVCYGOEF-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.29 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-tert-butyl-N,N-dimethyl-3,4-dihydropyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-tert-butyl-N,N-dimethyl-3,4-dihydropyridin-2-amine?
The IUPAC name of 4-tert-butyl-N,N-dimethyl-3,4-dihydropyridin-2-amine (CID 129191316) is 4-tert-butyl-N,N-dimethyl-3,4-dihydropyridin-2-amine.
What is the SMILES notation for 4-tert-butyl-N,N-dimethyl-3,4-dihydropyridin-2-amine?
The canonical SMILES for 4-tert-butyl-N,N-dimethyl-3,4-dihydropyridin-2-amine is CN(C)C1=NC=CC(C(C)(C)C)C1.
What is the InChIKey of 4-tert-butyl-N,N-dimethyl-3,4-dihydropyridin-2-amine?
The InChIKey is LLJXAYLVCYGOEF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20N2/c1-11(2,3)9-6-7-12-10(8-9)13(4)5/h6-7,9H,8H2,1-5H3.
What are the key properties of 4-tert-butyl-N,N-dimethyl-3,4-dihydropyridin-2-amine?
4-tert-butyl-N,N-dimethyl-3,4-dihydropyridin-2-amine has a molecular weight of 180.29 g/mol, XLogP of 2.53, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-tert-butyl-N,N-dimethyl-3,4-dihydropyridin-2-amine is sourced from PubChem (CID 129191316), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).