C22H21N3O — CID 129191371
4-(3-cyano-1H-indol-5-yl)-N-cyclopentyl-N-methylbenzamide (PubChem CID 129191371) has the molecular formula C22H21N3O and a molecular weight of 343.43 g/mol. Its IUPAC name is 4-(3-cyano-1H-indol-5-yl)-N-cyclopentyl-N-methylbenzamide.
| Compound Name | 4-(3-cyano-1H-indol-5-yl)-N-cyclopentyl-N-methylbenzamide |
|---|---|
| PubChem CID | 129191371 |
| Molecular Formula | C22H21N3O |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.17 |
| IUPAC Name | 4-(3-cyano-1H-indol-5-yl)-N-cyclopentyl-N-methylbenzamide |
| SMILES | CN(C(=O)c1ccc(-c2ccc3[nH]cc(C#N)c3c2)cc1)C1CCCC1 |
| InChI | InChI=1S/C22H21N3O/c1-25(19-4-2-3-5-19)22(26)16-8-6-15(7-9-16)17-10-11-21-20(12-17)18(13-23)14-24-21/h6-12,14,19,24H,2-5H2,1H3 |
| InChIKey | JXKCQZFWKWPTLL-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 59.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |