About N-cyclopentyl-5-(2,2-dimethylpropyl)pyridin-2-amine
N-cyclopentyl-5-(2,2-dimethylpropyl)pyridin-2-amine (PubChem CID 129191461) has the molecular formula C15H24N2
and a molecular weight of 232.37 g/mol. Its IUPAC name is N-cyclopentyl-5-(2,2-dimethylpropyl)pyridin-2-amine.
Molecular Properties
| Compound Name | N-cyclopentyl-5-(2,2-dimethylpropyl)pyridin-2-amine |
| PubChem CID | 129191461 |
| Molecular Formula | C15H24N2 |
| Molecular Weight | 232.37 g/mol |
| Exact Mass | 232.19 |
| IUPAC Name | N-cyclopentyl-5-(2,2-dimethylpropyl)pyridin-2-amine |
| SMILES | CC(C)(C)Cc1ccc(NC2CCCC2)nc1 |
| InChI | InChI=1S/C15H24N2/c1-15(2,3)10-12-8-9-14(16-11-12)17-13-6-4-5-7-13/h8-9,11,13H,4-7,10H2,1-3H3,(H,16,17) |
| InChIKey | LAAWPCGERPAXAD-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.37 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-cyclopentyl-5-(2,2-dimethylpropyl)pyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclopentyl-5-(2,2-dimethylpropyl)pyridin-2-amine?
The IUPAC name of N-cyclopentyl-5-(2,2-dimethylpropyl)pyridin-2-amine (CID 129191461) is N-cyclopentyl-5-(2,2-dimethylpropyl)pyridin-2-amine.
What is the SMILES notation for N-cyclopentyl-5-(2,2-dimethylpropyl)pyridin-2-amine?
The canonical SMILES for N-cyclopentyl-5-(2,2-dimethylpropyl)pyridin-2-amine is CC(C)(C)Cc1ccc(NC2CCCC2)nc1.
What is the InChIKey of N-cyclopentyl-5-(2,2-dimethylpropyl)pyridin-2-amine?
The InChIKey is LAAWPCGERPAXAD-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24N2/c1-15(2,3)10-12-8-9-14(16-11-12)17-13-6-4-5-7-13/h8-9,11,13H,4-7,10H2,1-3H3,(H,16,17).
What are the key properties of N-cyclopentyl-5-(2,2-dimethylpropyl)pyridin-2-amine?
N-cyclopentyl-5-(2,2-dimethylpropyl)pyridin-2-amine has a molecular weight of 232.37 g/mol, XLogP of 4.02, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclopentyl-5-(2,2-dimethylpropyl)pyridin-2-amine is sourced from PubChem (CID 129191461), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).