C19H27NO5S — CID 129191574
(1R,7aR)-1-[5-(4-ethyl-2,6,7-trioxabicyclo[2.2.2]octan-1-yl)pent-1-ynyl]-5,5-dimethyl-7,7a-dihydro-1H-[1,3]thiazolo[3,4-c][1,3]oxazol-3-one (PubChem CID 129191574) has the molecular formula C19H27NO5S and a molecular weight of 381.49 g/mol. Its IUPAC name is (1R,7aR)-1-[5-(4-ethyl-2,6,7-trioxabicyclo[2.2.2]octan-1-yl)pent-1-ynyl]-5,5-dimethyl-7,7a-dihydro-1H-[1,3]thiazolo[3,4-c][1,3]oxazol-3-one.
| Compound Name | (1R,7aR)-1-[5-(4-ethyl-2,6,7-trioxabicyclo[2.2.2]octan-1-yl)pent-1-ynyl]-5,5-dimethyl-7,7a-dihydro-1H-[1,3]thiazolo[3,4-c][1,3]oxazol-3-one |
|---|---|
| PubChem CID | 129191574 |
| Molecular Formula | C19H27NO5S |
| Molecular Weight | 381.49 g/mol |
| Exact Mass | 381.16 |
| IUPAC Name | (1R,7aR)-1-[5-(4-ethyl-2,6,7-trioxabicyclo[2.2.2]octan-1-yl)pent-1-ynyl]-5,5-dimethyl-7,7a-dihydro-1H-[1,3]thiazolo[3,4-c][1,3]oxazol-3-one |
| SMILES | CCC12COC(CCCC#C[C@H]3OC(=O)N4[C@H]3CSC4(C)C)(OC1)OC2 |
| InChI | InChI=1S/C19H27NO5S/c1-4-18-11-22-19(23-12-18,24-13-18)9-7-5-6-8-15-14-10-26-17(2,3)20(14)16(21)25-15/h14-15H,4-5,7,9-13H2,1-3H3/t14-,15+,18?,19?/m0/s1 |
| InChIKey | AJEPYPUFUYSTDD-WINGESFGSA-N |
| XLogP | 2.96 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.49 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|