C17H19N — CID 129191777
2-[(2E,4Z)-hexa-2,4-dien-3-yl]-3,8-dimethylideneazecine (PubChem CID 129191777) has the molecular formula C17H19N and a molecular weight of 237.35 g/mol. Its IUPAC name is 2-[(2E,4Z)-hexa-2,4-dien-3-yl]-3,8-dimethylideneazecine.
| Compound Name | 2-[(2E,4Z)-hexa-2,4-dien-3-yl]-3,8-dimethylideneazecine |
|---|---|
| PubChem CID | 129191777 |
| Molecular Formula | C17H19N |
| Molecular Weight | 237.35 g/mol |
| Exact Mass | 237.15 |
| IUPAC Name | 2-[(2E,4Z)-hexa-2,4-dien-3-yl]-3,8-dimethylideneazecine |
| SMILES | C=c1ccccc(=C)c(C(/C=C\C)=C/C)ncc1 |
| InChI | InChI=1S/C17H19N/c1-5-9-16(6-2)17-15(4)11-8-7-10-14(3)12-13-18-17/h5-13H,3-4H2,1-2H3/b9-5-,10-7-,11-8+,13-12+,16-6+,18-17+ |
| InChIKey | PWEJDEXYQBDZIH-IODDHGEZSA-N |
| XLogP | 3.01 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.35 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|