C13H20ClNO — CID 129191872
[(2S,6R)-6-[(3Z,5E)-5-chlorohepta-1,3,5-trien-2-yl]oxan-2-yl]methanamine (PubChem CID 129191872) has the molecular formula C13H20ClNO and a molecular weight of 241.76 g/mol. Its IUPAC name is [(2S,6R)-6-[(3Z,5E)-5-chlorohepta-1,3,5-trien-2-yl]oxan-2-yl]methanamine.
| Compound Name | [(2S,6R)-6-[(3Z,5E)-5-chlorohepta-1,3,5-trien-2-yl]oxan-2-yl]methanamine |
|---|---|
| PubChem CID | 129191872 |
| Molecular Formula | C13H20ClNO |
| Molecular Weight | 241.76 g/mol |
| Exact Mass | 241.12 |
| IUPAC Name | [(2S,6R)-6-[(3Z,5E)-5-chlorohepta-1,3,5-trien-2-yl]oxan-2-yl]methanamine |
| SMILES | C=C(/C=C\C(Cl)=C/C)[C@H]1CCC[C@@H](CN)O1 |
| InChI | InChI=1S/C13H20ClNO/c1-3-11(14)8-7-10(2)13-6-4-5-12(9-15)16-13/h3,7-8,12-13H,2,4-6,9,15H2,1H3/b8-7-,11-3+/t12-,13+/m0/s1 |
| InChIKey | PLFJXSVXPATAEL-CKSJCIRESA-N |
| XLogP | 3.14 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.76 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|