About 5-(1,3-dioxolan-2-yl)-1,3-oxathiolane
5-(1,3-dioxolan-2-yl)-1,3-oxathiolane (PubChem CID 129192037) has the molecular formula C6H10O3S
and a molecular weight of 162.21 g/mol. Its IUPAC name is 5-(1,3-dioxolan-2-yl)-1,3-oxathiolane.
Molecular Properties
| Compound Name | 5-(1,3-dioxolan-2-yl)-1,3-oxathiolane |
| PubChem CID | 129192037 |
| Molecular Formula | C6H10O3S |
| Molecular Weight | 162.21 g/mol |
| Exact Mass | 162.04 |
| IUPAC Name | 5-(1,3-dioxolan-2-yl)-1,3-oxathiolane |
| SMILES | C1COC(C2CSCO2)O1 |
| InChI | InChI=1S/C6H10O3S/c1-2-8-6(7-1)5-3-10-4-9-5/h5-6H,1-4H2 |
| InChIKey | JVLMIHQWNFJNBH-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.21 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-(1,3-dioxolan-2-yl)-1,3-oxathiolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(1,3-dioxolan-2-yl)-1,3-oxathiolane?
The IUPAC name of 5-(1,3-dioxolan-2-yl)-1,3-oxathiolane (CID 129192037) is 5-(1,3-dioxolan-2-yl)-1,3-oxathiolane.
What is the SMILES notation for 5-(1,3-dioxolan-2-yl)-1,3-oxathiolane?
The canonical SMILES for 5-(1,3-dioxolan-2-yl)-1,3-oxathiolane is C1COC(C2CSCO2)O1.
What is the InChIKey of 5-(1,3-dioxolan-2-yl)-1,3-oxathiolane?
The InChIKey is JVLMIHQWNFJNBH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10O3S/c1-2-8-6(7-1)5-3-10-4-9-5/h5-6H,1-4H2.
What are the key properties of 5-(1,3-dioxolan-2-yl)-1,3-oxathiolane?
5-(1,3-dioxolan-2-yl)-1,3-oxathiolane has a molecular weight of 162.21 g/mol, XLogP of 0.45, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(1,3-dioxolan-2-yl)-1,3-oxathiolane is sourced from PubChem (CID 129192037), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).