C30H40O13S — CID 129192301
[(3R,4S,6R)-3,5-diacetyloxy-6-[(3S,4S,6S)-5-acetyloxy-2-(acetyloxymethyl)-4-methyl-6-phenylsulfanyloxan-3-yl]oxy-4-methyloxan-2-yl]methyl acetate (PubChem CID 129192301) has the molecular formula C30H40O13S and a molecular weight of 640.70 g/mol. Its IUPAC name is [(3R,4S,6R)-3,5-diacetyloxy-6-[(3S,4S,6S)-5-acetyloxy-2-(acetyloxymethyl)-4-methyl-6-phenylsulfanyloxan-3-yl]oxy-4-methyloxan-2-yl]methyl acetate.
| Compound Name | [(3R,4S,6R)-3,5-diacetyloxy-6-[(3S,4S,6S)-5-acetyloxy-2-(acetyloxymethyl)-4-methyl-6-phenylsulfanyloxan-3-yl]oxy-4-methyloxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 129192301 |
| Molecular Formula | C30H40O13S |
| Molecular Weight | 640.70 g/mol |
| Exact Mass | 640.22 |
| IUPAC Name | [(3R,4S,6R)-3,5-diacetyloxy-6-[(3S,4S,6S)-5-acetyloxy-2-(acetyloxymethyl)-4-methyl-6-phenylsulfanyloxan-3-yl]oxy-4-methyloxan-2-yl]methyl acetate |
| SMILES | CC(=O)OCC1O[C@@H](Sc2ccccc2)C(OC(C)=O)[C@@H](C)[C@@H]1O[C@@H]1OC(COC(C)=O)[C@H](OC(C)=O)[C@H](C)C1OC(C)=O |
| InChI | InChI=1S/C30H40O13S/c1-15-25(38-19(5)33)23(13-36-17(3)31)41-29(27(15)39-20(6)34)43-26-16(2)28(40-21(7)35)30(42-24(26)14-37-18(4)32)44-22-11-9-8-10-12-22/h8-12,15-16,23-30H,13-14H2,1-7H3/t15-,16-,23?,24?,25+,26-,27?,28?,29-,30-/m0/s1 |
| InChIKey | AXNGCEVRKWQXQJ-HJGUKIAXSA-N |
| XLogP | 2.81 |
| TPSA | 159.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.70 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|