C24H38O11 — CID 129192316
[(3R,4S,6R)-3,5-diacetyloxy-6-[(3R,4S,6S)-5-acetyloxy-2-ethyl-4,6-dimethyloxan-3-yl]oxy-4-methyloxan-2-yl]methyl acetate (PubChem CID 129192316) has the molecular formula C24H38O11 and a molecular weight of 502.56 g/mol. Its IUPAC name is [(3R,4S,6R)-3,5-diacetyloxy-6-[(3R,4S,6S)-5-acetyloxy-2-ethyl-4,6-dimethyloxan-3-yl]oxy-4-methyloxan-2-yl]methyl acetate.
| Compound Name | [(3R,4S,6R)-3,5-diacetyloxy-6-[(3R,4S,6S)-5-acetyloxy-2-ethyl-4,6-dimethyloxan-3-yl]oxy-4-methyloxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 129192316 |
| Molecular Formula | C24H38O11 |
| Molecular Weight | 502.56 g/mol |
| Exact Mass | 502.24 |
| IUPAC Name | [(3R,4S,6R)-3,5-diacetyloxy-6-[(3R,4S,6S)-5-acetyloxy-2-ethyl-4,6-dimethyloxan-3-yl]oxy-4-methyloxan-2-yl]methyl acetate |
| SMILES | CCC1O[C@@H](C)C(OC(C)=O)[C@@H](C)[C@H]1O[C@@H]1OC(COC(C)=O)[C@H](OC(C)=O)[C@H](C)C1OC(C)=O |
| InChI | InChI=1S/C24H38O11/c1-9-18-21(11(2)20(13(4)30-18)31-15(6)26)35-24-23(33-17(8)28)12(3)22(32-16(7)27)19(34-24)10-29-14(5)25/h11-13,18-24H,9-10H2,1-8H3/t11-,12+,13+,18?,19?,20?,21-,22-,23?,24+/m1/s1 |
| InChIKey | AGCMNDRTQPRHHQ-QMANZMNKSA-N |
| XLogP | 1.92 |
| TPSA | 132.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.56 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|