C6H8N2 — CID 129192389
2,4,5,6-tetrahydropyrrolo[3,4-b]pyrrole (PubChem CID 129192389) has the molecular formula C6H8N2 and a molecular weight of 108.14 g/mol. Its IUPAC name is 2,4,5,6-tetrahydropyrrolo[3,4-b]pyrrole.
| Compound Name | 2,4,5,6-tetrahydropyrrolo[3,4-b]pyrrole |
|---|---|
| PubChem CID | 129192389 |
| Molecular Formula | C6H8N2 |
| Molecular Weight | 108.14 g/mol |
| Exact Mass | 108.07 |
| IUPAC Name | 2,4,5,6-tetrahydropyrrolo[3,4-b]pyrrole |
| SMILES | C1=C2CNCC2=NC1 |
| InChI | InChI=1S/C6H8N2/c1-2-8-6-4-7-3-5(1)6/h1,7H,2-4H2 |
| InChIKey | PQDANXCNUDIWJD-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 108.14 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |