C21H27FN8O — CID 129192888
2-[4-[(aminomethylideneamino)methylideneamino]anilino]-5-fluoro-6-[[(1R,2S)-2-(methylamino)cyclohexyl]amino]pyridine-3-carboxamide (PubChem CID 129192888) has the molecular formula C21H27FN8O and a molecular weight of 426.50 g/mol. Its IUPAC name is 2-[4-[(aminomethylideneamino)methylideneamino]anilino]-5-fluoro-6-[[(1R,2S)-2-(methylamino)cyclohexyl]amino]pyridine-3-carboxamide.
| Compound Name | 2-[4-[(aminomethylideneamino)methylideneamino]anilino]-5-fluoro-6-[[(1R,2S)-2-(methylamino)cyclohexyl]amino]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 129192888 |
| Molecular Formula | C21H27FN8O |
| Molecular Weight | 426.50 g/mol |
| Exact Mass | 426.23 |
| IUPAC Name | 2-[4-[(aminomethylideneamino)methylideneamino]anilino]-5-fluoro-6-[[(1R,2S)-2-(methylamino)cyclohexyl]amino]pyridine-3-carboxamide |
| SMILES | CN[C@H]1CCCC[C@H]1Nc1nc(Nc2ccc(/N=C/N=C/N)cc2)c(C(N)=O)cc1F |
| InChI | InChI=1S/C21H27FN8O/c1-25-17-4-2-3-5-18(17)29-21-16(22)10-15(19(24)31)20(30-21)28-14-8-6-13(7-9-14)27-12-26-11-23/h6-12,17-18,25H,2-5H2,1H3,(H2,24,31)(H2,23,26,27)(H2,28,29,30)/t17-,18+/m0/s1 |
| InChIKey | RCAFDZFCSFBRIX-ZWKOTPCHSA-N |
| XLogP | 2.65 |
| TPSA | 142.81 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.50 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|