C30H34F3NO3 — CID 129193005
[(E)-[3-cyclohexyl-1-oxo-1-[9-propyl-9-(3,3,3-trifluoropropyl)fluoren-2-yl]propan-2-ylidene]amino] acetate (PubChem CID 129193005) has the molecular formula C30H34F3NO3 and a molecular weight of 513.60 g/mol. Its IUPAC name is [(E)-[3-cyclohexyl-1-oxo-1-[9-propyl-9-(3,3,3-trifluoropropyl)fluoren-2-yl]propan-2-ylidene]amino] acetate.
| Compound Name | [(E)-[3-cyclohexyl-1-oxo-1-[9-propyl-9-(3,3,3-trifluoropropyl)fluoren-2-yl]propan-2-ylidene]amino] acetate |
|---|---|
| PubChem CID | 129193005 |
| Molecular Formula | C30H34F3NO3 |
| Molecular Weight | 513.60 g/mol |
| Exact Mass | 513.25 |
| IUPAC Name | [(E)-[3-cyclohexyl-1-oxo-1-[9-propyl-9-(3,3,3-trifluoropropyl)fluoren-2-yl]propan-2-ylidene]amino] acetate |
| SMILES | CCCC1(CCC(F)(F)F)c2ccccc2-c2ccc(C(=O)/C(CC3CCCCC3)=N/OC(C)=O)cc21 |
| InChI | InChI=1S/C30H34F3NO3/c1-3-15-29(16-17-30(31,32)33)25-12-8-7-11-23(25)24-14-13-22(19-26(24)29)28(36)27(34-37-20(2)35)18-21-9-5-4-6-10-21/h7-8,11-14,19,21H,3-6,9-10,15-18H2,1-2H3/b34-27+ |
| InChIKey | OQEHWHJSTCWUPS-DNGXXSEMSA-N |
| XLogP | 8.17 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.60 |
| LogP ≤ 5 | 8.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|