C24H28F3N3O — CID 129193607
3-[5-(piperidin-1-ylmethyl)-3-[4-(trifluoromethoxy)phenyl]indol-1-yl]propan-1-amine (PubChem CID 129193607) has the molecular formula C24H28F3N3O and a molecular weight of 431.50 g/mol. Its IUPAC name is 3-[5-(piperidin-1-ylmethyl)-3-[4-(trifluoromethoxy)phenyl]indol-1-yl]propan-1-amine.
| Compound Name | 3-[5-(piperidin-1-ylmethyl)-3-[4-(trifluoromethoxy)phenyl]indol-1-yl]propan-1-amine |
|---|---|
| PubChem CID | 129193607 |
| Molecular Formula | C24H28F3N3O |
| Molecular Weight | 431.50 g/mol |
| Exact Mass | 431.22 |
| IUPAC Name | 3-[5-(piperidin-1-ylmethyl)-3-[4-(trifluoromethoxy)phenyl]indol-1-yl]propan-1-amine |
| SMILES | NCCCn1cc(-c2ccc(OC(F)(F)F)cc2)c2cc(CN3CCCCC3)ccc21 |
| InChI | InChI=1S/C24H28F3N3O/c25-24(26,27)31-20-8-6-19(7-9-20)22-17-30(14-4-11-28)23-10-5-18(15-21(22)23)16-29-12-2-1-3-13-29/h5-10,15,17H,1-4,11-14,16,28H2 |
| InChIKey | RSLPFJBKTJBCCF-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 43.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.50 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |