C23H30O3 — CID 129193807
(13S)-3,13-dimethyl-17-(2-methyl-1,3-dioxolan-2-yl)-7,8,9,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-11-one (PubChem CID 129193807) has the molecular formula C23H30O3 and a molecular weight of 354.49 g/mol. Its IUPAC name is (13S)-3,13-dimethyl-17-(2-methyl-1,3-dioxolan-2-yl)-7,8,9,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-11-one.
| Compound Name | (13S)-3,13-dimethyl-17-(2-methyl-1,3-dioxolan-2-yl)-7,8,9,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-11-one |
|---|---|
| PubChem CID | 129193807 |
| Molecular Formula | C23H30O3 |
| Molecular Weight | 354.49 g/mol |
| Exact Mass | 354.22 |
| IUPAC Name | (13S)-3,13-dimethyl-17-(2-methyl-1,3-dioxolan-2-yl)-7,8,9,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-11-one |
| SMILES | Cc1ccc2c(c1)CCC1C2C(=O)C[C@@]2(C)C1CCC2C1(C)OCCO1 |
| InChI | InChI=1S/C23H30O3/c1-14-4-6-16-15(12-14)5-7-17-18-8-9-20(23(3)25-10-11-26-23)22(18,2)13-19(24)21(16)17/h4,6,12,17-18,20-21H,5,7-11,13H2,1-3H3/t17?,18?,20?,21?,22-/m0/s1 |
| InChIKey | SVNYOQQZBCHMIR-SHTBAORNSA-N |
| XLogP | 4.41 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.49 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |