C21H22FN6O9P2+ — CID 129193848
[(2R,3R,4R,5R)-5-(6-benzamidopurin-9-yl)-2-[[2-cyanoethoxy(methoxy)phosphoryl]oxymethyl]-4-fluorooxolan-3-yl]oxy-hydroxy-oxophosphanium (PubChem CID 129193848) has the molecular formula C21H22FN6O9P2+ and a molecular weight of 583.39 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-5-(6-benzamidopurin-9-yl)-2-[[2-cyanoethoxy(methoxy)phosphoryl]oxymethyl]-4-fluorooxolan-3-yl]oxy-hydroxy-oxophosphanium.
| Compound Name | [(2R,3R,4R,5R)-5-(6-benzamidopurin-9-yl)-2-[[2-cyanoethoxy(methoxy)phosphoryl]oxymethyl]-4-fluorooxolan-3-yl]oxy-hydroxy-oxophosphanium |
|---|---|
| PubChem CID | 129193848 |
| Molecular Formula | C21H22FN6O9P2+ |
| Molecular Weight | 583.39 g/mol |
| Exact Mass | 583.09 |
| IUPAC Name | [(2R,3R,4R,5R)-5-(6-benzamidopurin-9-yl)-2-[[2-cyanoethoxy(methoxy)phosphoryl]oxymethyl]-4-fluorooxolan-3-yl]oxy-hydroxy-oxophosphanium |
| SMILES | COP(=O)(OCCC#N)OC[C@H]1O[C@@H](n2cnc3c(NC(=O)c4ccccc4)ncnc32)[C@H](F)[C@@H]1O[P+](=O)O |
| InChI | InChI=1S/C21H21FN6O9P2/c1-33-39(32,34-9-5-8-23)35-10-14-17(37-38(30)31)15(22)21(36-14)28-12-26-16-18(24-11-25-19(16)28)27-20(29)13-6-3-2-4-7-13/h2-4,6-7,11-12,14-15,17,21H,5,9-10H2,1H3,(H-,24,25,27,29,30,31)/p+1/t14-,15-,17-,21-,39?/m1/s1 |
| InChIKey | DVCALTYFFYIUII-VZPRIXGYSA-O |
| XLogP | 3.05 |
| TPSA | 197.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.39 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|