About N-[(2Z,4Z)-4-propan-2-ylhexa-2,4-dien-2-yl]methanimine
N-[(2Z,4Z)-4-propan-2-ylhexa-2,4-dien-2-yl]methanimine (PubChem CID 129194065) has the molecular formula C10H17N
and a molecular weight of 151.25 g/mol. Its IUPAC name is N-[(2Z,4Z)-4-propan-2-ylhexa-2,4-dien-2-yl]methanimine.
Molecular Properties
| Compound Name | N-[(2Z,4Z)-4-propan-2-ylhexa-2,4-dien-2-yl]methanimine |
| PubChem CID | 129194065 |
| Molecular Formula | C10H17N |
| Molecular Weight | 151.25 g/mol |
| Exact Mass | 151.14 |
| IUPAC Name | N-[(2Z,4Z)-4-propan-2-ylhexa-2,4-dien-2-yl]methanimine |
| SMILES | C=N/C(C)=C\C(=C/C)C(C)C |
| InChI | InChI=1S/C10H17N/c1-6-10(8(2)3)7-9(4)11-5/h6-8H,5H2,1-4H3/b9-7-,10-6+ |
| InChIKey | FEENKBHXNGKRRX-ODUODFHUSA-N |
| XLogP | 3.19 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.25 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-[(2Z,4Z)-4-propan-2-ylhexa-2,4-dien-2-yl]methanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2Z,4Z)-4-propan-2-ylhexa-2,4-dien-2-yl]methanimine?
The IUPAC name of N-[(2Z,4Z)-4-propan-2-ylhexa-2,4-dien-2-yl]methanimine (CID 129194065) is N-[(2Z,4Z)-4-propan-2-ylhexa-2,4-dien-2-yl]methanimine.
What is the SMILES notation for N-[(2Z,4Z)-4-propan-2-ylhexa-2,4-dien-2-yl]methanimine?
The canonical SMILES for N-[(2Z,4Z)-4-propan-2-ylhexa-2,4-dien-2-yl]methanimine is C=N/C(C)=C\C(=C/C)C(C)C.
What is the InChIKey of N-[(2Z,4Z)-4-propan-2-ylhexa-2,4-dien-2-yl]methanimine?
The InChIKey is FEENKBHXNGKRRX-ODUODFHUSA-N. The full InChI is InChI=1S/C10H17N/c1-6-10(8(2)3)7-9(4)11-5/h6-8H,5H2,1-4H3/b9-7-,10-6+.
What are the key properties of N-[(2Z,4Z)-4-propan-2-ylhexa-2,4-dien-2-yl]methanimine?
N-[(2Z,4Z)-4-propan-2-ylhexa-2,4-dien-2-yl]methanimine has a molecular weight of 151.25 g/mol, XLogP of 3.19, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2Z,4Z)-4-propan-2-ylhexa-2,4-dien-2-yl]methanimine is sourced from PubChem (CID 129194065), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).