About (2Z)-2-ethylidene-N,3-dimethylheptan-1-imine
(2Z)-2-ethylidene-N,3-dimethylheptan-1-imine (PubChem CID 129194089) has the molecular formula C11H21N
and a molecular weight of 167.30 g/mol. Its IUPAC name is (2Z)-2-ethylidene-N,3-dimethylheptan-1-imine.
Molecular Properties
| Compound Name | (2Z)-2-ethylidene-N,3-dimethylheptan-1-imine |
| PubChem CID | 129194089 |
| Molecular Formula | C11H21N |
| Molecular Weight | 167.30 g/mol |
| Exact Mass | 167.17 |
| IUPAC Name | (2Z)-2-ethylidene-N,3-dimethylheptan-1-imine |
| SMILES | C/C=C(\C=N\C)C(C)CCCC |
| InChI | InChI=1S/C11H21N/c1-5-7-8-10(3)11(6-2)9-12-4/h6,9-10H,5,7-8H2,1-4H3/b11-6+,12-9+ |
| InChIKey | OJWDLJLHTDQJET-MOPWJCKASA-N |
| XLogP | 3.46 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.30 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (2Z)-2-ethylidene-N,3-dimethylheptan-1-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z)-2-ethylidene-N,3-dimethylheptan-1-imine?
The IUPAC name of (2Z)-2-ethylidene-N,3-dimethylheptan-1-imine (CID 129194089) is (2Z)-2-ethylidene-N,3-dimethylheptan-1-imine.
What is the SMILES notation for (2Z)-2-ethylidene-N,3-dimethylheptan-1-imine?
The canonical SMILES for (2Z)-2-ethylidene-N,3-dimethylheptan-1-imine is C/C=C(\C=N\C)C(C)CCCC.
What is the InChIKey of (2Z)-2-ethylidene-N,3-dimethylheptan-1-imine?
The InChIKey is OJWDLJLHTDQJET-MOPWJCKASA-N. The full InChI is InChI=1S/C11H21N/c1-5-7-8-10(3)11(6-2)9-12-4/h6,9-10H,5,7-8H2,1-4H3/b11-6+,12-9+.
What are the key properties of (2Z)-2-ethylidene-N,3-dimethylheptan-1-imine?
(2Z)-2-ethylidene-N,3-dimethylheptan-1-imine has a molecular weight of 167.30 g/mol, XLogP of 3.46, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z)-2-ethylidene-N,3-dimethylheptan-1-imine is sourced from PubChem (CID 129194089), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).