C25H20F3N3O4S2 — CID 129194206
1,1,1-trifluoro-N-[2-[(3S,4R)-4-hydroxy-3-[[5-(1,3-thiazol-5-yl)-2-pyridinyl]methyl]-3,4-dihydro-2H-chromen-7-yl]phenyl]methanesulfonamide (PubChem CID 129194206) has the molecular formula C25H20F3N3O4S2 and a molecular weight of 547.58 g/mol. Its IUPAC name is 1,1,1-trifluoro-N-[2-[(3S,4R)-4-hydroxy-3-[[5-(1,3-thiazol-5-yl)-2-pyridinyl]methyl]-3,4-dihydro-2H-chromen-7-yl]phenyl]methanesulfonamide.
| Compound Name | 1,1,1-trifluoro-N-[2-[(3S,4R)-4-hydroxy-3-[[5-(1,3-thiazol-5-yl)-2-pyridinyl]methyl]-3,4-dihydro-2H-chromen-7-yl]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 129194206 |
| Molecular Formula | C25H20F3N3O4S2 |
| Molecular Weight | 547.58 g/mol |
| Exact Mass | 547.08 |
| IUPAC Name | 1,1,1-trifluoro-N-[2-[(3S,4R)-4-hydroxy-3-[[5-(1,3-thiazol-5-yl)-2-pyridinyl]methyl]-3,4-dihydro-2H-chromen-7-yl]phenyl]methanesulfonamide |
| SMILES | O=S(=O)(Nc1ccccc1-c1ccc2c(c1)OC[C@H](Cc1ccc(-c3cncs3)cn1)[C@H]2O)C(F)(F)F |
| InChI | InChI=1S/C25H20F3N3O4S2/c26-25(27,28)37(33,34)31-21-4-2-1-3-19(21)15-6-8-20-22(10-15)35-13-17(24(20)32)9-18-7-5-16(11-30-18)23-12-29-14-36-23/h1-8,10-12,14,17,24,31-32H,9,13H2/t17-,24+/m0/s1 |
| InChIKey | PUYZTXIRVCPLJZ-BXKMTCNYSA-N |
| XLogP | 5.42 |
| TPSA | 101.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.58 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |