About 1-cyclohexa-2,4-dien-1-yl-1-methylhydrazine
1-cyclohexa-2,4-dien-1-yl-1-methylhydrazine (PubChem CID 129194267) has the molecular formula C7H12N2
and a molecular weight of 124.19 g/mol. Its IUPAC name is 1-cyclohexa-2,4-dien-1-yl-1-methylhydrazine.
Molecular Properties
| Compound Name | 1-cyclohexa-2,4-dien-1-yl-1-methylhydrazine |
| PubChem CID | 129194267 |
| Molecular Formula | C7H12N2 |
| Molecular Weight | 124.19 g/mol |
| Exact Mass | 124.10 |
| IUPAC Name | 1-cyclohexa-2,4-dien-1-yl-1-methylhydrazine |
| SMILES | CN(N)C1C=CC=CC1 |
| InChI | InChI=1S/C7H12N2/c1-9(8)7-5-3-2-4-6-7/h2-5,7H,6,8H2,1H3 |
| InChIKey | SDPYHWRZBCLBNX-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 124.19 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-cyclohexa-2,4-dien-1-yl-1-methylhydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclohexa-2,4-dien-1-yl-1-methylhydrazine?
The IUPAC name of 1-cyclohexa-2,4-dien-1-yl-1-methylhydrazine (CID 129194267) is 1-cyclohexa-2,4-dien-1-yl-1-methylhydrazine.
What is the SMILES notation for 1-cyclohexa-2,4-dien-1-yl-1-methylhydrazine?
The canonical SMILES for 1-cyclohexa-2,4-dien-1-yl-1-methylhydrazine is CN(N)C1C=CC=CC1.
What is the InChIKey of 1-cyclohexa-2,4-dien-1-yl-1-methylhydrazine?
The InChIKey is SDPYHWRZBCLBNX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N2/c1-9(8)7-5-3-2-4-6-7/h2-5,7H,6,8H2,1H3.
What are the key properties of 1-cyclohexa-2,4-dien-1-yl-1-methylhydrazine?
1-cyclohexa-2,4-dien-1-yl-1-methylhydrazine has a molecular weight of 124.19 g/mol, XLogP of 0.68, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclohexa-2,4-dien-1-yl-1-methylhydrazine is sourced from PubChem (CID 129194267), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).