C26H22F3N3O4S2 — CID 129194554
1,1,1-trifluoro-N-[2-[(3S,4R)-4-hydroxy-3-[[5-(2-methyl-1,3-thiazol-5-yl)-2-pyridinyl]methyl]-3,4-dihydro-2H-chromen-7-yl]phenyl]methanesulfonamide (PubChem CID 129194554) has the molecular formula C26H22F3N3O4S2 and a molecular weight of 561.61 g/mol. Its IUPAC name is 1,1,1-trifluoro-N-[2-[(3S,4R)-4-hydroxy-3-[[5-(2-methyl-1,3-thiazol-5-yl)-2-pyridinyl]methyl]-3,4-dihydro-2H-chromen-7-yl]phenyl]methanesulfonamide.
| Compound Name | 1,1,1-trifluoro-N-[2-[(3S,4R)-4-hydroxy-3-[[5-(2-methyl-1,3-thiazol-5-yl)-2-pyridinyl]methyl]-3,4-dihydro-2H-chromen-7-yl]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 129194554 |
| Molecular Formula | C26H22F3N3O4S2 |
| Molecular Weight | 561.61 g/mol |
| Exact Mass | 561.10 |
| IUPAC Name | 1,1,1-trifluoro-N-[2-[(3S,4R)-4-hydroxy-3-[[5-(2-methyl-1,3-thiazol-5-yl)-2-pyridinyl]methyl]-3,4-dihydro-2H-chromen-7-yl]phenyl]methanesulfonamide |
| SMILES | Cc1ncc(-c2ccc(C[C@H]3COc4cc(-c5ccccc5NS(=O)(=O)C(F)(F)F)ccc4[C@@H]3O)nc2)s1 |
| InChI | InChI=1S/C26H22F3N3O4S2/c1-15-30-13-24(37-15)17-6-8-19(31-12-17)10-18-14-36-23-11-16(7-9-21(23)25(18)33)20-4-2-3-5-22(20)32-38(34,35)26(27,28)29/h2-9,11-13,18,25,32-33H,10,14H2,1H3/t18-,25+/m0/s1 |
| InChIKey | CHGQJTKFALOZIR-AVRWGWEMSA-N |
| XLogP | 5.73 |
| TPSA | 101.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.61 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |