C13H21N3 — CID 129194793
(5E)-2,11,15-triazabicyclo[11.3.0]hexadeca-1(13),5,11-triene (PubChem CID 129194793) has the molecular formula C13H21N3 and a molecular weight of 219.33 g/mol. Its IUPAC name is (5E)-2,11,15-triazabicyclo[11.3.0]hexadeca-1(13),5,11-triene.
| Compound Name | (5E)-2,11,15-triazabicyclo[11.3.0]hexadeca-1(13),5,11-triene |
|---|---|
| PubChem CID | 129194793 |
| Molecular Formula | C13H21N3 |
| Molecular Weight | 219.33 g/mol |
| Exact Mass | 219.17 |
| IUPAC Name | (5E)-2,11,15-triazabicyclo[11.3.0]hexadeca-1(13),5,11-triene |
| SMILES | C1=N\CCCC/C=C/CCNC2=C/1CNC2 |
| InChI | InChI=1S/C13H21N3/c1-2-4-6-8-16-13-11-15-10-12(13)9-14-7-5-3-1/h2,4,9,15-16H,1,3,5-8,10-11H2/b4-2+,14-9- |
| InChIKey | XAFIWBCHIBEWSI-QDQHRRMGSA-N |
| XLogP | 1.63 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.33 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|