About ethyl 3-(2-aminoethyl)benzoate
ethyl 3-(2-aminoethyl)benzoate (PubChem CID 12919507) has the molecular formula C11H15NO2
and a molecular weight of 193.25 g/mol. Its IUPAC name is ethyl 3-(2-aminoethyl)benzoate.
Molecular Properties
| Compound Name | ethyl 3-(2-aminoethyl)benzoate |
| PubChem CID | 12919507 |
| Molecular Formula | C11H15NO2 |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | ethyl 3-(2-aminoethyl)benzoate |
| SMILES | CCOC(=O)c1cccc(CCN)c1 |
| InChI | InChI=1S/C11H15NO2/c1-2-14-11(13)10-5-3-4-9(8-10)6-7-12/h3-5,8H,2,6-7,12H2,1H3 |
| InChIKey | FEUSXEHUNBRXCB-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethyl 3-(2-aminoethyl)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-(2-aminoethyl)benzoate?
The IUPAC name of ethyl 3-(2-aminoethyl)benzoate (CID 12919507) is ethyl 3-(2-aminoethyl)benzoate.
What is the SMILES notation for ethyl 3-(2-aminoethyl)benzoate?
The canonical SMILES for ethyl 3-(2-aminoethyl)benzoate is CCOC(=O)c1cccc(CCN)c1.
What is the InChIKey of ethyl 3-(2-aminoethyl)benzoate?
The InChIKey is FEUSXEHUNBRXCB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NO2/c1-2-14-11(13)10-5-3-4-9(8-10)6-7-12/h3-5,8H,2,6-7,12H2,1H3.
What are the key properties of ethyl 3-(2-aminoethyl)benzoate?
ethyl 3-(2-aminoethyl)benzoate has a molecular weight of 193.25 g/mol, XLogP of 1.36, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-(2-aminoethyl)benzoate is sourced from PubChem (CID 12919507), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).