C20H21N5O2S — CID 129195143
(3R)-3-[5-(9-methylcarbazol-2-yl)-1,1-dioxo-1,2,5-thiadiazolidin-2-yl]pyrrolidine-1-carbonitrile (PubChem CID 129195143) has the molecular formula C20H21N5O2S and a molecular weight of 395.49 g/mol. Its IUPAC name is (3R)-3-[5-(9-methylcarbazol-2-yl)-1,1-dioxo-1,2,5-thiadiazolidin-2-yl]pyrrolidine-1-carbonitrile.
| Compound Name | (3R)-3-[5-(9-methylcarbazol-2-yl)-1,1-dioxo-1,2,5-thiadiazolidin-2-yl]pyrrolidine-1-carbonitrile |
|---|---|
| PubChem CID | 129195143 |
| Molecular Formula | C20H21N5O2S |
| Molecular Weight | 395.49 g/mol |
| Exact Mass | 395.14 |
| IUPAC Name | (3R)-3-[5-(9-methylcarbazol-2-yl)-1,1-dioxo-1,2,5-thiadiazolidin-2-yl]pyrrolidine-1-carbonitrile |
| SMILES | Cn1c2ccccc2c2ccc(N3CCN([C@@H]4CCN(C#N)C4)S3(=O)=O)cc21 |
| InChI | InChI=1S/C20H21N5O2S/c1-22-19-5-3-2-4-17(19)18-7-6-15(12-20(18)22)24-10-11-25(28(24,26)27)16-8-9-23(13-16)14-21/h2-7,12,16H,8-11,13H2,1H3/t16-/m1/s1 |
| InChIKey | RDKAVXKUDTXJRS-MRXNPFEDSA-N |
| XLogP | 2.25 |
| TPSA | 72.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.49 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|