C24H30N2O4 — CID 12919532
4-[2-[[2-[(3S,5R)-3,5-dimethylpiperidin-1-yl]-5-methoxybenzoyl]amino]ethyl]benzoic acid (PubChem CID 12919532) has the molecular formula C24H30N2O4 and a molecular weight of 410.51 g/mol. Its IUPAC name is 4-[2-[[2-[(3S,5R)-3,5-dimethylpiperidin-1-yl]-5-methoxybenzoyl]amino]ethyl]benzoic acid.
| Compound Name | 4-[2-[[2-[(3S,5R)-3,5-dimethylpiperidin-1-yl]-5-methoxybenzoyl]amino]ethyl]benzoic acid |
|---|---|
| PubChem CID | 12919532 |
| Molecular Formula | C24H30N2O4 |
| Molecular Weight | 410.51 g/mol |
| Exact Mass | 410.22 |
| IUPAC Name | 4-[2-[[2-[(3S,5R)-3,5-dimethylpiperidin-1-yl]-5-methoxybenzoyl]amino]ethyl]benzoic acid |
| SMILES | COc1ccc(N2C[C@H](C)C[C@H](C)C2)c(C(=O)NCCc2ccc(C(=O)O)cc2)c1 |
| InChI | InChI=1S/C24H30N2O4/c1-16-12-17(2)15-26(14-16)22-9-8-20(30-3)13-21(22)23(27)25-11-10-18-4-6-19(7-5-18)24(28)29/h4-9,13,16-17H,10-12,14-15H2,1-3H3,(H,25,27)(H,28,29)/t16-,17+ |
| InChIKey | RGTZTIGWDGHKJV-CALCHBBNSA-N |
| XLogP | 3.85 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.51 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|