About 1-[N-[(E)-5,5-dimethylhex-3-en-3-yl]-C-ethenylcarbonimidoyl]-N-propan-2-ylpyrazol-3-amine
1-[N-[(E)-5,5-dimethylhex-3-en-3-yl]-C-ethenylcarbonimidoyl]-N-propan-2-ylpyrazol-3-amine (PubChem CID 129195825) has the molecular formula C17H28N4
and a molecular weight of 288.44 g/mol. Its IUPAC name is 1-[N-[(E)-5,5-dimethylhex-3-en-3-yl]-C-ethenylcarbonimidoyl]-N-propan-2-ylpyrazol-3-amine.
Molecular Properties
| Compound Name | 1-[N-[(E)-5,5-dimethylhex-3-en-3-yl]-C-ethenylcarbonimidoyl]-N-propan-2-ylpyrazol-3-amine |
| PubChem CID | 129195825 |
| Molecular Formula | C17H28N4 |
| Molecular Weight | 288.44 g/mol |
| Exact Mass | 288.23 |
| IUPAC Name | 1-[N-[(E)-5,5-dimethylhex-3-en-3-yl]-C-ethenylcarbonimidoyl]-N-propan-2-ylpyrazol-3-amine |
| SMILES | C=C/C(=N\C(=C\C(C)(C)C)CC)n1ccc(NC(C)C)n1 |
| InChI | InChI=1S/C17H28N4/c1-8-14(12-17(5,6)7)19-16(9-2)21-11-10-15(20-21)18-13(3)4/h9-13H,2,8H2,1,3-7H3,(H,18,20)/b14-12+,19-16+ |
| InChIKey | KXWGGVFLEORFSB-AIFHPCJLSA-N |
| XLogP | 4.48 |
| TPSA | 42.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.44 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 1-[N-[(E)-5,5-dimethylhex-3-en-3-yl]-C-ethenylcarbonimidoyl]-N-propan-2-ylpyrazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[N-[(E)-5,5-dimethylhex-3-en-3-yl]-C-ethenylcarbonimidoyl]-N-propan-2-ylpyrazol-3-amine?
The IUPAC name of 1-[N-[(E)-5,5-dimethylhex-3-en-3-yl]-C-ethenylcarbonimidoyl]-N-propan-2-ylpyrazol-3-amine (CID 129195825) is 1-[N-[(E)-5,5-dimethylhex-3-en-3-yl]-C-ethenylcarbonimidoyl]-N-propan-2-ylpyrazol-3-amine.
What is the SMILES notation for 1-[N-[(E)-5,5-dimethylhex-3-en-3-yl]-C-ethenylcarbonimidoyl]-N-propan-2-ylpyrazol-3-amine?
The canonical SMILES for 1-[N-[(E)-5,5-dimethylhex-3-en-3-yl]-C-ethenylcarbonimidoyl]-N-propan-2-ylpyrazol-3-amine is C=C/C(=N\C(=C\C(C)(C)C)CC)n1ccc(NC(C)C)n1.
What is the InChIKey of 1-[N-[(E)-5,5-dimethylhex-3-en-3-yl]-C-ethenylcarbonimidoyl]-N-propan-2-ylpyrazol-3-amine?
The InChIKey is KXWGGVFLEORFSB-AIFHPCJLSA-N. The full InChI is InChI=1S/C17H28N4/c1-8-14(12-17(5,6)7)19-16(9-2)21-11-10-15(20-21)18-13(3)4/h9-13H,2,8H2,1,3-7H3,(H,18,20)/b14-12+,19-16+.
What are the key properties of 1-[N-[(E)-5,5-dimethylhex-3-en-3-yl]-C-ethenylcarbonimidoyl]-N-propan-2-ylpyrazol-3-amine?
1-[N-[(E)-5,5-dimethylhex-3-en-3-yl]-C-ethenylcarbonimidoyl]-N-propan-2-ylpyrazol-3-amine has a molecular weight of 288.44 g/mol, XLogP of 4.48, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[N-[(E)-5,5-dimethylhex-3-en-3-yl]-C-ethenylcarbonimidoyl]-N-propan-2-ylpyrazol-3-amine is sourced from PubChem (CID 129195825), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).