C9H12F3N — CID 129195925
(1E,3E)-N,N-dimethyl-3-(trifluoromethyl)hexa-1,3,5-trien-1-amine (PubChem CID 129195925) has the molecular formula C9H12F3N and a molecular weight of 191.20 g/mol. Its IUPAC name is (1E,3E)-N,N-dimethyl-3-(trifluoromethyl)hexa-1,3,5-trien-1-amine.
| Compound Name | (1E,3E)-N,N-dimethyl-3-(trifluoromethyl)hexa-1,3,5-trien-1-amine |
|---|---|
| PubChem CID | 129195925 |
| Molecular Formula | C9H12F3N |
| Molecular Weight | 191.20 g/mol |
| Exact Mass | 191.09 |
| IUPAC Name | (1E,3E)-N,N-dimethyl-3-(trifluoromethyl)hexa-1,3,5-trien-1-amine |
| SMILES | C=C/C=C(\C=C\N(C)C)C(F)(F)F |
| InChI | InChI=1S/C9H12F3N/c1-4-5-8(9(10,11)12)6-7-13(2)3/h4-7H,1H2,2-3H3/b7-6+,8-5+ |
| InChIKey | AREXLGWDYYEMAW-ZCOYIIAOSA-N |
| XLogP | 2.74 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.20 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|