C9H11N3 — CID 129196346
5-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-1H-1,2,4-triazole (PubChem CID 129196346) has the molecular formula C9H11N3 and a molecular weight of 161.21 g/mol. Its IUPAC name is 5-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-1H-1,2,4-triazole.
| Compound Name | 5-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 129196346 |
| Molecular Formula | C9H11N3 |
| Molecular Weight | 161.21 g/mol |
| Exact Mass | 161.10 |
| IUPAC Name | 5-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-1H-1,2,4-triazole |
| SMILES | C=C/C=C\C=C(/C)c1ncn[nH]1 |
| InChI | InChI=1S/C9H11N3/c1-3-4-5-6-8(2)9-10-7-11-12-9/h3-7H,1H2,2H3,(H,10,11,12)/b5-4-,8-6+ |
| InChIKey | XRQYNRSMHDQIQY-GSGSLZOQSA-N |
| XLogP | 1.95 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.21 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|