C11H19FO — CID 129196424
(2E,4Z)-3-fluoro-1-methoxy-6,7-dimethylocta-2,4-diene (PubChem CID 129196424) has the molecular formula C11H19FO and a molecular weight of 186.27 g/mol. Its IUPAC name is (2E,4Z)-3-fluoro-1-methoxy-6,7-dimethylocta-2,4-diene.
| Compound Name | (2E,4Z)-3-fluoro-1-methoxy-6,7-dimethylocta-2,4-diene |
|---|---|
| PubChem CID | 129196424 |
| Molecular Formula | C11H19FO |
| Molecular Weight | 186.27 g/mol |
| Exact Mass | 186.14 |
| IUPAC Name | (2E,4Z)-3-fluoro-1-methoxy-6,7-dimethylocta-2,4-diene |
| SMILES | COC/C=C(F)\C=C/C(C)C(C)C |
| InChI | InChI=1S/C11H19FO/c1-9(2)10(3)5-6-11(12)7-8-13-4/h5-7,9-10H,8H2,1-4H3/b6-5-,11-7+ |
| InChIKey | CIYFDFYPAWMJGA-GNLLZQBYSA-N |
| XLogP | 3.33 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.27 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|