About 4-amino-3-ethylcyclohexa-1,3-diene-1-carbonitrile
4-amino-3-ethylcyclohexa-1,3-diene-1-carbonitrile (PubChem CID 129196445) has the molecular formula C9H12N2
and a molecular weight of 148.21 g/mol. Its IUPAC name is 4-amino-3-ethylcyclohexa-1,3-diene-1-carbonitrile.
Molecular Properties
| Compound Name | 4-amino-3-ethylcyclohexa-1,3-diene-1-carbonitrile |
| PubChem CID | 129196445 |
| Molecular Formula | C9H12N2 |
| Molecular Weight | 148.21 g/mol |
| Exact Mass | 148.10 |
| IUPAC Name | 4-amino-3-ethylcyclohexa-1,3-diene-1-carbonitrile |
| SMILES | CCC1=C(N)CCC(C#N)=C1 |
| InChI | InChI=1S/C9H12N2/c1-2-8-5-7(6-10)3-4-9(8)11/h5H,2-4,11H2,1H3 |
| InChIKey | IMQVQWVPGGFPAA-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 49.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.21 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-amino-3-ethylcyclohexa-1,3-diene-1-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-3-ethylcyclohexa-1,3-diene-1-carbonitrile?
The IUPAC name of 4-amino-3-ethylcyclohexa-1,3-diene-1-carbonitrile (CID 129196445) is 4-amino-3-ethylcyclohexa-1,3-diene-1-carbonitrile.
What is the SMILES notation for 4-amino-3-ethylcyclohexa-1,3-diene-1-carbonitrile?
The canonical SMILES for 4-amino-3-ethylcyclohexa-1,3-diene-1-carbonitrile is CCC1=C(N)CCC(C#N)=C1.
What is the InChIKey of 4-amino-3-ethylcyclohexa-1,3-diene-1-carbonitrile?
The InChIKey is IMQVQWVPGGFPAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2/c1-2-8-5-7(6-10)3-4-9(8)11/h5H,2-4,11H2,1H3.
What are the key properties of 4-amino-3-ethylcyclohexa-1,3-diene-1-carbonitrile?
4-amino-3-ethylcyclohexa-1,3-diene-1-carbonitrile has a molecular weight of 148.21 g/mol, XLogP of 1.85, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-3-ethylcyclohexa-1,3-diene-1-carbonitrile is sourced from PubChem (CID 129196445), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).