About N'-[(2Z)-4-aminopenta-2,4-dien-2-yl]ethanimidamide
N'-[(2Z)-4-aminopenta-2,4-dien-2-yl]ethanimidamide (PubChem CID 129196479) has the molecular formula C7H13N3
and a molecular weight of 139.20 g/mol. Its IUPAC name is N'-[(2Z)-4-aminopenta-2,4-dien-2-yl]ethanimidamide.
Molecular Properties
| Compound Name | N'-[(2Z)-4-aminopenta-2,4-dien-2-yl]ethanimidamide |
| PubChem CID | 129196479 |
| Molecular Formula | C7H13N3 |
| Molecular Weight | 139.20 g/mol |
| Exact Mass | 139.11 |
| IUPAC Name | N'-[(2Z)-4-aminopenta-2,4-dien-2-yl]ethanimidamide |
| SMILES | C=C(N)/C=C(C)\N=C(/C)N |
| InChI | InChI=1S/C7H13N3/c1-5(8)4-6(2)10-7(3)9/h4H,1,8H2,2-3H3,(H2,9,10)/b6-4- |
| InChIKey | IMBUWKMRQONPHH-XQRVVYSFSA-N |
| XLogP | 0.74 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 139.20 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N'-[(2Z)-4-aminopenta-2,4-dien-2-yl]ethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[(2Z)-4-aminopenta-2,4-dien-2-yl]ethanimidamide?
The IUPAC name of N'-[(2Z)-4-aminopenta-2,4-dien-2-yl]ethanimidamide (CID 129196479) is N'-[(2Z)-4-aminopenta-2,4-dien-2-yl]ethanimidamide.
What is the SMILES notation for N'-[(2Z)-4-aminopenta-2,4-dien-2-yl]ethanimidamide?
The canonical SMILES for N'-[(2Z)-4-aminopenta-2,4-dien-2-yl]ethanimidamide is C=C(N)/C=C(C)\N=C(/C)N.
What is the InChIKey of N'-[(2Z)-4-aminopenta-2,4-dien-2-yl]ethanimidamide?
The InChIKey is IMBUWKMRQONPHH-XQRVVYSFSA-N. The full InChI is InChI=1S/C7H13N3/c1-5(8)4-6(2)10-7(3)9/h4H,1,8H2,2-3H3,(H2,9,10)/b6-4-.
What are the key properties of N'-[(2Z)-4-aminopenta-2,4-dien-2-yl]ethanimidamide?
N'-[(2Z)-4-aminopenta-2,4-dien-2-yl]ethanimidamide has a molecular weight of 139.20 g/mol, XLogP of 0.74, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[(2Z)-4-aminopenta-2,4-dien-2-yl]ethanimidamide is sourced from PubChem (CID 129196479), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).