About (2S)-1-(3,3-dihydroxypropyl)-2-hydroxy-2H-pyrrol-5-one
(2S)-1-(3,3-dihydroxypropyl)-2-hydroxy-2H-pyrrol-5-one (PubChem CID 129196502) has the molecular formula C7H11NO4
and a molecular weight of 173.17 g/mol. Its IUPAC name is (2S)-1-(3,3-dihydroxypropyl)-2-hydroxy-2H-pyrrol-5-one.
Molecular Properties
| Compound Name | (2S)-1-(3,3-dihydroxypropyl)-2-hydroxy-2H-pyrrol-5-one |
| PubChem CID | 129196502 |
| Molecular Formula | C7H11NO4 |
| Molecular Weight | 173.17 g/mol |
| Exact Mass | 173.07 |
| IUPAC Name | (2S)-1-(3,3-dihydroxypropyl)-2-hydroxy-2H-pyrrol-5-one |
| SMILES | O=C1C=C[C@H](O)N1CCC(O)O |
| InChI | InChI=1S/C7H11NO4/c9-5-1-2-6(10)8(5)4-3-7(11)12/h1-2,5,7,9,11-12H,3-4H2/t5-/m0/s1 |
| InChIKey | SLIXKVSNMFDHKA-YFKPBYRVSA-N |
| XLogP | -1.60 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.17 |
| LogP ≤ 5 | -1.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze (2S)-1-(3,3-dihydroxypropyl)-2-hydroxy-2H-pyrrol-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-1-(3,3-dihydroxypropyl)-2-hydroxy-2H-pyrrol-5-one?
The IUPAC name of (2S)-1-(3,3-dihydroxypropyl)-2-hydroxy-2H-pyrrol-5-one (CID 129196502) is (2S)-1-(3,3-dihydroxypropyl)-2-hydroxy-2H-pyrrol-5-one.
What is the SMILES notation for (2S)-1-(3,3-dihydroxypropyl)-2-hydroxy-2H-pyrrol-5-one?
The canonical SMILES for (2S)-1-(3,3-dihydroxypropyl)-2-hydroxy-2H-pyrrol-5-one is O=C1C=C[C@H](O)N1CCC(O)O.
What is the InChIKey of (2S)-1-(3,3-dihydroxypropyl)-2-hydroxy-2H-pyrrol-5-one?
The InChIKey is SLIXKVSNMFDHKA-YFKPBYRVSA-N. The full InChI is InChI=1S/C7H11NO4/c9-5-1-2-6(10)8(5)4-3-7(11)12/h1-2,5,7,9,11-12H,3-4H2/t5-/m0/s1.
What are the key properties of (2S)-1-(3,3-dihydroxypropyl)-2-hydroxy-2H-pyrrol-5-one?
(2S)-1-(3,3-dihydroxypropyl)-2-hydroxy-2H-pyrrol-5-one has a molecular weight of 173.17 g/mol, XLogP of -1.60, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-1-(3,3-dihydroxypropyl)-2-hydroxy-2H-pyrrol-5-one is sourced from PubChem (CID 129196502), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).