C30H36ClF5N4O4 — CID 129197241
2-chloro-N,N-dimethyl-6-[4-[[1-[(2R)-3,3,4,4,4-pentafluoro-2-hydroxy-2-(3-methoxyphenyl)butanoyl]piperidin-4-yl]methyl]piperidin-1-yl]pyridine-3-carboxamide (PubChem CID 129197241) has the molecular formula C30H36ClF5N4O4 and a molecular weight of 647.09 g/mol. Its IUPAC name is 2-chloro-N,N-dimethyl-6-[4-[[1-[(2R)-3,3,4,4,4-pentafluoro-2-hydroxy-2-(3-methoxyphenyl)butanoyl]piperidin-4-yl]methyl]piperidin-1-yl]pyridine-3-carboxamide.
| Compound Name | 2-chloro-N,N-dimethyl-6-[4-[[1-[(2R)-3,3,4,4,4-pentafluoro-2-hydroxy-2-(3-methoxyphenyl)butanoyl]piperidin-4-yl]methyl]piperidin-1-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 129197241 |
| Molecular Formula | C30H36ClF5N4O4 |
| Molecular Weight | 647.09 g/mol |
| Exact Mass | 646.23 |
| IUPAC Name | 2-chloro-N,N-dimethyl-6-[4-[[1-[(2R)-3,3,4,4,4-pentafluoro-2-hydroxy-2-(3-methoxyphenyl)butanoyl]piperidin-4-yl]methyl]piperidin-1-yl]pyridine-3-carboxamide |
| SMILES | COc1cccc([C@@](O)(C(=O)N2CCC(CC3CCN(c4ccc(C(=O)N(C)C)c(Cl)n4)CC3)CC2)C(F)(F)C(F)(F)F)c1 |
| InChI | InChI=1S/C30H36ClF5N4O4/c1-38(2)26(41)23-7-8-24(37-25(23)31)39-13-9-19(10-14-39)17-20-11-15-40(16-12-20)27(42)28(43,29(32,33)30(34,35)36)21-5-4-6-22(18-21)44-3/h4-8,18-20,43H,9-17H2,1-3H3/t28-/m1/s1 |
| InChIKey | WQIZLKMTQMOVLJ-MUUNZHRXSA-N |
| XLogP | 5.38 |
| TPSA | 86.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.09 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|