About 4-methyl-3H-2,1-benzothiazine
4-methyl-3H-2,1-benzothiazine (PubChem CID 129197539) has the molecular formula C9H9NS
and a molecular weight of 163.25 g/mol. Its IUPAC name is 4-methyl-3H-2,1-benzothiazine.
Molecular Properties
| Compound Name | 4-methyl-3H-2,1-benzothiazine |
| PubChem CID | 129197539 |
| Molecular Formula | C9H9NS |
| Molecular Weight | 163.25 g/mol |
| Exact Mass | 163.05 |
| IUPAC Name | 4-methyl-3H-2,1-benzothiazine |
| SMILES | CC1=c2ccccc2=NSC1 |
| InChI | InChI=1S/C9H9NS/c1-7-6-11-10-9-5-3-2-4-8(7)9/h2-5H,6H2,1H3 |
| InChIKey | MXSRMCYTOXFCSJ-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.25 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-methyl-3H-2,1-benzothiazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-3H-2,1-benzothiazine?
The IUPAC name of 4-methyl-3H-2,1-benzothiazine (CID 129197539) is 4-methyl-3H-2,1-benzothiazine.
What is the SMILES notation for 4-methyl-3H-2,1-benzothiazine?
The canonical SMILES for 4-methyl-3H-2,1-benzothiazine is CC1=c2ccccc2=NSC1.
What is the InChIKey of 4-methyl-3H-2,1-benzothiazine?
The InChIKey is MXSRMCYTOXFCSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9NS/c1-7-6-11-10-9-5-3-2-4-8(7)9/h2-5H,6H2,1H3.
What are the key properties of 4-methyl-3H-2,1-benzothiazine?
4-methyl-3H-2,1-benzothiazine has a molecular weight of 163.25 g/mol, XLogP of 1.14, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-3H-2,1-benzothiazine is sourced from PubChem (CID 129197539), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).