C27H20ClN3 — CID 129197599
2-[4-(4-chlorophenyl)phenyl]-4,6-diphenyl-1,4-dihydro-1,3,5-triazine (PubChem CID 129197599) has the molecular formula C27H20ClN3 and a molecular weight of 421.93 g/mol. Its IUPAC name is 2-[4-(4-chlorophenyl)phenyl]-4,6-diphenyl-1,4-dihydro-1,3,5-triazine.
| Compound Name | 2-[4-(4-chlorophenyl)phenyl]-4,6-diphenyl-1,4-dihydro-1,3,5-triazine |
|---|---|
| PubChem CID | 129197599 |
| Molecular Formula | C27H20ClN3 |
| Molecular Weight | 421.93 g/mol |
| Exact Mass | 421.13 |
| IUPAC Name | 2-[4-(4-chlorophenyl)phenyl]-4,6-diphenyl-1,4-dihydro-1,3,5-triazine |
| SMILES | Clc1ccc(-c2ccc(C3=NC(c4ccccc4)N=C(c4ccccc4)N3)cc2)cc1 |
| InChI | InChI=1S/C27H20ClN3/c28-24-17-15-20(16-18-24)19-11-13-23(14-12-19)27-30-25(21-7-3-1-4-8-21)29-26(31-27)22-9-5-2-6-10-22/h1-18,25H,(H,29,30,31) |
| InChIKey | YTGBPHJPPQQDOE-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 36.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.93 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |