C18H24BrN — CID 129197671
3-(3-bromophenyl)-2,3,4,4a,4b,5,6,7,8,8a,9,9a-dodecahydro-1H-carbazole (PubChem CID 129197671) has the molecular formula C18H24BrN and a molecular weight of 334.30 g/mol. Its IUPAC name is 3-(3-bromophenyl)-2,3,4,4a,4b,5,6,7,8,8a,9,9a-dodecahydro-1H-carbazole.
| Compound Name | 3-(3-bromophenyl)-2,3,4,4a,4b,5,6,7,8,8a,9,9a-dodecahydro-1H-carbazole |
|---|---|
| PubChem CID | 129197671 |
| Molecular Formula | C18H24BrN |
| Molecular Weight | 334.30 g/mol |
| Exact Mass | 333.11 |
| IUPAC Name | 3-(3-bromophenyl)-2,3,4,4a,4b,5,6,7,8,8a,9,9a-dodecahydro-1H-carbazole |
| SMILES | Brc1cccc(C2CCC3NC4CCCCC4C3C2)c1 |
| InChI | InChI=1S/C18H24BrN/c19-14-5-3-4-12(10-14)13-8-9-18-16(11-13)15-6-1-2-7-17(15)20-18/h3-5,10,13,15-18,20H,1-2,6-9,11H2 |
| InChIKey | ZEAAIBGIELXKDB-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.30 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |