C29H37F2NO3 — CID 129197869
(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl) 4-(4-cyclohepta-2,4,6-trien-1-ylcyclohexyl)-2,6-difluorobenzoate (PubChem CID 129197869) has the molecular formula C29H37F2NO3 and a molecular weight of 485.62 g/mol. Its IUPAC name is (1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl) 4-(4-cyclohepta-2,4,6-trien-1-ylcyclohexyl)-2,6-difluorobenzoate.
| Compound Name | (1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl) 4-(4-cyclohepta-2,4,6-trien-1-ylcyclohexyl)-2,6-difluorobenzoate |
|---|---|
| PubChem CID | 129197869 |
| Molecular Formula | C29H37F2NO3 |
| Molecular Weight | 485.62 g/mol |
| Exact Mass | 485.27 |
| IUPAC Name | (1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl) 4-(4-cyclohepta-2,4,6-trien-1-ylcyclohexyl)-2,6-difluorobenzoate |
| SMILES | CC1(C)CC(OC(=O)c2c(F)cc(C3CCC(C4C=CC=CC=C4)CC3)cc2F)CC(C)(C)N1O |
| InChI | InChI=1S/C29H37F2NO3/c1-28(2)17-23(18-29(3,4)32(28)34)35-27(33)26-24(30)15-22(16-25(26)31)21-13-11-20(12-14-21)19-9-7-5-6-8-10-19/h5-10,15-16,19-21,23,34H,11-14,17-18H2,1-4H3 |
| InChIKey | QDMMWAXSZOSLPX-UHFFFAOYSA-N |
| XLogP | 7.10 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.62 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |