C18H25NO4 — CID 129198362
N-[[(3aS,6R,6aR)-6-ethyl-2,2-dimethyl-6,6a-dihydro-4H-furo[3,4-d][1,3]dioxol-3a-yl]methyl]-N-methylbenzamide (PubChem CID 129198362) has the molecular formula C18H25NO4 and a molecular weight of 319.40 g/mol. Its IUPAC name is N-[[(3aS,6R,6aR)-6-ethyl-2,2-dimethyl-6,6a-dihydro-4H-furo[3,4-d][1,3]dioxol-3a-yl]methyl]-N-methylbenzamide.
| Compound Name | N-[[(3aS,6R,6aR)-6-ethyl-2,2-dimethyl-6,6a-dihydro-4H-furo[3,4-d][1,3]dioxol-3a-yl]methyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 129198362 |
| Molecular Formula | C18H25NO4 |
| Molecular Weight | 319.40 g/mol |
| Exact Mass | 319.18 |
| IUPAC Name | N-[[(3aS,6R,6aR)-6-ethyl-2,2-dimethyl-6,6a-dihydro-4H-furo[3,4-d][1,3]dioxol-3a-yl]methyl]-N-methylbenzamide |
| SMILES | CC[C@H]1OC[C@]2(CN(C)C(=O)c3ccccc3)OC(C)(C)O[C@H]12 |
| InChI | InChI=1S/C18H25NO4/c1-5-14-15-18(12-21-14,23-17(2,3)22-15)11-19(4)16(20)13-9-7-6-8-10-13/h6-10,14-15H,5,11-12H2,1-4H3/t14-,15-,18+/m1/s1 |
| InChIKey | VGFFUXODBHQFGZ-RKVPGOIHSA-N |
| XLogP | 2.46 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.40 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |