C27H26N4O4 — CID 129198473
(2S)-1-(2-aminoacetyl)-N-(6'-aminospiro[1H-2-benzofuran-3,9'-xanthene]-3'-yl)pyrrolidine-2-carboxamide (PubChem CID 129198473) has the molecular formula C27H26N4O4 and a molecular weight of 470.53 g/mol. Its IUPAC name is (2S)-1-(2-aminoacetyl)-N-(6'-aminospiro[1H-2-benzofuran-3,9'-xanthene]-3'-yl)pyrrolidine-2-carboxamide.
| Compound Name | (2S)-1-(2-aminoacetyl)-N-(6'-aminospiro[1H-2-benzofuran-3,9'-xanthene]-3'-yl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 129198473 |
| Molecular Formula | C27H26N4O4 |
| Molecular Weight | 470.53 g/mol |
| Exact Mass | 470.20 |
| IUPAC Name | (2S)-1-(2-aminoacetyl)-N-(6'-aminospiro[1H-2-benzofuran-3,9'-xanthene]-3'-yl)pyrrolidine-2-carboxamide |
| SMILES | NCC(=O)N1CCC[C@H]1C(=O)Nc1ccc2c(c1)Oc1cc(N)ccc1C21OCc2ccccc21 |
| InChI | InChI=1S/C27H26N4O4/c28-14-25(32)31-11-3-6-22(31)26(33)30-18-8-10-21-24(13-18)35-23-12-17(29)7-9-20(23)27(21)19-5-2-1-4-16(19)15-34-27/h1-2,4-5,7-10,12-13,22H,3,6,11,14-15,28-29H2,(H,30,33)/t22-,27?/m0/s1 |
| InChIKey | XDIBZNTXQYAOOL-YMQLSTQVSA-N |
| XLogP | 3.08 |
| TPSA | 119.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.53 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|