C21H28N4O6S — CID 129198732
3-[2-[3-(benzotriazol-2-yl)-4-hydroxyphenyl]ethyl-(2,2-dimethoxyethyl)amino]propane-1-sulfonic acid (PubChem CID 129198732) has the molecular formula C21H28N4O6S and a molecular weight of 464.54 g/mol. Its IUPAC name is 3-[2-[3-(benzotriazol-2-yl)-4-hydroxyphenyl]ethyl-(2,2-dimethoxyethyl)amino]propane-1-sulfonic acid.
| Compound Name | 3-[2-[3-(benzotriazol-2-yl)-4-hydroxyphenyl]ethyl-(2,2-dimethoxyethyl)amino]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 129198732 |
| Molecular Formula | C21H28N4O6S |
| Molecular Weight | 464.54 g/mol |
| Exact Mass | 464.17 |
| IUPAC Name | 3-[2-[3-(benzotriazol-2-yl)-4-hydroxyphenyl]ethyl-(2,2-dimethoxyethyl)amino]propane-1-sulfonic acid |
| SMILES | COC(CN(CCCS(=O)(=O)O)CCc1ccc(O)c(-n2nc3ccccc3n2)c1)OC |
| InChI | InChI=1S/C21H28N4O6S/c1-30-21(31-2)15-24(11-5-13-32(27,28)29)12-10-16-8-9-20(26)19(14-16)25-22-17-6-3-4-7-18(17)23-25/h3-4,6-9,14,21,26H,5,10-13,15H2,1-2H3,(H,27,28,29) |
| InChIKey | NRAVUWMKOOZOGD-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 127.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.54 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|