C19H29N5O6 — CID 129198885
(2R)-N-[(4R)-1-(carbamoylamino)-5-oxoheptan-4-yl]-2-[[2-(2,5-dioxopyrrol-1-yl)acetyl]amino]-3-methylbutanamide (PubChem CID 129198885) has the molecular formula C19H29N5O6 and a molecular weight of 423.47 g/mol. Its IUPAC name is (2R)-N-[(4R)-1-(carbamoylamino)-5-oxoheptan-4-yl]-2-[[2-(2,5-dioxopyrrol-1-yl)acetyl]amino]-3-methylbutanamide.
| Compound Name | (2R)-N-[(4R)-1-(carbamoylamino)-5-oxoheptan-4-yl]-2-[[2-(2,5-dioxopyrrol-1-yl)acetyl]amino]-3-methylbutanamide |
|---|---|
| PubChem CID | 129198885 |
| Molecular Formula | C19H29N5O6 |
| Molecular Weight | 423.47 g/mol |
| Exact Mass | 423.21 |
| IUPAC Name | (2R)-N-[(4R)-1-(carbamoylamino)-5-oxoheptan-4-yl]-2-[[2-(2,5-dioxopyrrol-1-yl)acetyl]amino]-3-methylbutanamide |
| SMILES | CCC(=O)[C@@H](CCCNC(N)=O)NC(=O)[C@H](NC(=O)CN1C(=O)C=CC1=O)C(C)C |
| InChI | InChI=1S/C19H29N5O6/c1-4-13(25)12(6-5-9-21-19(20)30)22-18(29)17(11(2)3)23-14(26)10-24-15(27)7-8-16(24)28/h7-8,11-12,17H,4-6,9-10H2,1-3H3,(H,22,29)(H,23,26)(H3,20,21,30)/t12-,17-/m1/s1 |
| InChIKey | YMYNFOPWPCRQHJ-SJKOYZFVSA-N |
| XLogP | -1.04 |
| TPSA | 167.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.47 |
| LogP ≤ 5 | -1.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|