C24H24Br4O2 — CID 129198895
(1S,2R,6R,7S)-8,8-bis(3,5-dibromo-4-methoxyphenyl)tricyclo[5.2.1.02,6]decane (PubChem CID 129198895) has the molecular formula C24H24Br4O2 and a molecular weight of 664.07 g/mol. Its IUPAC name is (1S,2R,6R,7S)-8,8-bis(3,5-dibromo-4-methoxyphenyl)tricyclo[5.2.1.02,6]decane.
| Compound Name | (1S,2R,6R,7S)-8,8-bis(3,5-dibromo-4-methoxyphenyl)tricyclo[5.2.1.02,6]decane |
|---|---|
| PubChem CID | 129198895 |
| Molecular Formula | C24H24Br4O2 |
| Molecular Weight | 664.07 g/mol |
| Exact Mass | 659.85 |
| IUPAC Name | (1S,2R,6R,7S)-8,8-bis(3,5-dibromo-4-methoxyphenyl)tricyclo[5.2.1.02,6]decane |
| SMILES | COc1c(Br)cc(C2(c3cc(Br)c(OC)c(Br)c3)C[C@@H]3C[C@H]2[C@@H]2CCC[C@H]32)cc1Br |
| InChI | InChI=1S/C24H24Br4O2/c1-29-22-18(25)7-13(8-19(22)26)24(14-9-20(27)23(30-2)21(28)10-14)11-12-6-17(24)16-5-3-4-15(12)16/h7-10,12,15-17H,3-6,11H2,1-2H3/t12-,15+,16+,17-/m0/s1 |
| InChIKey | NZWDVQNXOKOESJ-DXEWXGHRSA-N |
| XLogP | 8.50 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.07 |
| LogP ≤ 5 | 8.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |