C29H12Cl4N2O5 — CID 129198914
2-(2,4-dichlorophenyl)-5-[2-(2,4-dichlorophenyl)-1,3-dioxoisoindole-5-carbonyl]isoindole-1,3-dione (PubChem CID 129198914) has the molecular formula C29H12Cl4N2O5 and a molecular weight of 610.24 g/mol. Its IUPAC name is 2-(2,4-dichlorophenyl)-5-[2-(2,4-dichlorophenyl)-1,3-dioxoisoindole-5-carbonyl]isoindole-1,3-dione.
| Compound Name | 2-(2,4-dichlorophenyl)-5-[2-(2,4-dichlorophenyl)-1,3-dioxoisoindole-5-carbonyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 129198914 |
| Molecular Formula | C29H12Cl4N2O5 |
| Molecular Weight | 610.24 g/mol |
| Exact Mass | 607.95 |
| IUPAC Name | 2-(2,4-dichlorophenyl)-5-[2-(2,4-dichlorophenyl)-1,3-dioxoisoindole-5-carbonyl]isoindole-1,3-dione |
| SMILES | O=C(c1ccc2c(c1)C(=O)N(c1ccc(Cl)cc1Cl)C2=O)c1ccc2c(c1)C(=O)N(c1ccc(Cl)cc1Cl)C2=O |
| InChI | InChI=1S/C29H12Cl4N2O5/c30-15-3-7-23(21(32)11-15)34-26(37)17-5-1-13(9-19(17)28(34)39)25(36)14-2-6-18-20(10-14)29(40)35(27(18)38)24-8-4-16(31)12-22(24)33/h1-12H |
| InChIKey | SJLJPQUSODQSJH-UHFFFAOYSA-N |
| XLogP | 7.13 |
| TPSA | 91.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.24 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|