C57H68O — CID 129198938
[4-[2-[4-methyl-3,5-bis(2,3,5,6-tetramethylphenyl)phenyl]propan-2-yl]-2,6-bis(2,3,5,6-tetramethylphenyl)phenyl]methanol (PubChem CID 129198938) has the molecular formula C57H68O and a molecular weight of 769.17 g/mol. Its IUPAC name is [4-[2-[4-methyl-3,5-bis(2,3,5,6-tetramethylphenyl)phenyl]propan-2-yl]-2,6-bis(2,3,5,6-tetramethylphenyl)phenyl]methanol.
| Compound Name | [4-[2-[4-methyl-3,5-bis(2,3,5,6-tetramethylphenyl)phenyl]propan-2-yl]-2,6-bis(2,3,5,6-tetramethylphenyl)phenyl]methanol |
|---|---|
| PubChem CID | 129198938 |
| Molecular Formula | C57H68O |
| Molecular Weight | 769.17 g/mol |
| Exact Mass | 768.53 |
| IUPAC Name | [4-[2-[4-methyl-3,5-bis(2,3,5,6-tetramethylphenyl)phenyl]propan-2-yl]-2,6-bis(2,3,5,6-tetramethylphenyl)phenyl]methanol |
| SMILES | Cc1cc(C)c(C)c(-c2cc(C(C)(C)c3cc(-c4c(C)c(C)cc(C)c4C)c(CO)c(-c4c(C)c(C)cc(C)c4C)c3)cc(-c3c(C)c(C)cc(C)c3C)c2C)c1C |
| InChI | InChI=1S/C57H68O/c1-29-20-30(2)38(10)53(37(29)9)48-24-46(25-49(45(48)17)54-39(11)31(3)21-32(4)40(54)12)57(18,19)47-26-50(55-41(13)33(5)22-34(6)42(55)14)52(28-58)51(27-47)56-43(15)35(7)23-36(8)44(56)16/h20-27,58H,28H2,1-19H3 |
| InChIKey | BZBAAIPXYYVKMH-UHFFFAOYSA-N |
| XLogP | 15.42 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 769.17 |
| LogP ≤ 5 | 15.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |