C16H15F3N4O5S2 — CID 129199441
1-[(3S)-4-methylidene-1,1-dioxothiolan-3-yl]-3-[4-(trifluoromethylsulfonyl)anilino]pyrazole-4-carboxamide (PubChem CID 129199441) has the molecular formula C16H15F3N4O5S2 and a molecular weight of 464.45 g/mol. Its IUPAC name is 1-[(3S)-4-methylidene-1,1-dioxothiolan-3-yl]-3-[4-(trifluoromethylsulfonyl)anilino]pyrazole-4-carboxamide.
| Compound Name | 1-[(3S)-4-methylidene-1,1-dioxothiolan-3-yl]-3-[4-(trifluoromethylsulfonyl)anilino]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 129199441 |
| Molecular Formula | C16H15F3N4O5S2 |
| Molecular Weight | 464.45 g/mol |
| Exact Mass | 464.04 |
| IUPAC Name | 1-[(3S)-4-methylidene-1,1-dioxothiolan-3-yl]-3-[4-(trifluoromethylsulfonyl)anilino]pyrazole-4-carboxamide |
| SMILES | C=C1CS(=O)(=O)C[C@H]1n1cc(C(N)=O)c(Nc2ccc(S(=O)(=O)C(F)(F)F)cc2)n1 |
| InChI | InChI=1S/C16H15F3N4O5S2/c1-9-7-29(25,26)8-13(9)23-6-12(14(20)24)15(22-23)21-10-2-4-11(5-3-10)30(27,28)16(17,18)19/h2-6,13H,1,7-8H2,(H2,20,24)(H,21,22)/t13-/m1/s1 |
| InChIKey | OEWRBKJRXIQSEM-CYBMUJFWSA-N |
| XLogP | 1.54 |
| TPSA | 141.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.45 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|