C17H19F3N6O3 — CID 129199494
1-[(3R,4S)-4-methanimidoyloxan-3-yl]-3-[[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]amino]pyrazole-4-carboxamide (PubChem CID 129199494) has the molecular formula C17H19F3N6O3 and a molecular weight of 412.37 g/mol. Its IUPAC name is 1-[(3R,4S)-4-methanimidoyloxan-3-yl]-3-[[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]amino]pyrazole-4-carboxamide.
| Compound Name | 1-[(3R,4S)-4-methanimidoyloxan-3-yl]-3-[[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]amino]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 129199494 |
| Molecular Formula | C17H19F3N6O3 |
| Molecular Weight | 412.37 g/mol |
| Exact Mass | 412.15 |
| IUPAC Name | 1-[(3R,4S)-4-methanimidoyloxan-3-yl]-3-[[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]amino]pyrazole-4-carboxamide |
| SMILES | [H]/N=C/[C@H]1CCOC[C@@H]1n1cc(C(N)=O)c(Nc2ccc(OCC(F)(F)F)nc2)n1 |
| InChI | InChI=1S/C17H19F3N6O3/c18-17(19,20)9-29-14-2-1-11(6-23-14)24-16-12(15(22)27)7-26(25-16)13-8-28-4-3-10(13)5-21/h1-2,5-7,10,13,21H,3-4,8-9H2,(H2,22,27)(H,24,25)/b21-5+/t10-,13+/m1/s1 |
| InChIKey | RMSYOGWZHCSOMH-ZHMJCDESSA-N |
| XLogP | 2.29 |
| TPSA | 128.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.37 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|