C28H34ClFN8O2 — CID 129199603
(Z)-2-amino-3-(N-amino-3-chloro-2-fluoroanilino)-N-[5-(methylamino)-9-oxo-10-propan-2-yl-8,16,18-triazatricyclo[13.2.1.02,7]octadeca-1(17),2(7),3,5,15-pentaen-14-yl]prop-2-enamide (PubChem CID 129199603) has the molecular formula C28H34ClFN8O2 and a molecular weight of 569.09 g/mol. Its IUPAC name is (Z)-2-amino-3-(N-amino-3-chloro-2-fluoroanilino)-N-[5-(methylamino)-9-oxo-10-propan-2-yl-8,16,18-triazatricyclo[13.2.1.02,7]octadeca-1(17),2(7),3,5,15-pentaen-14-yl]prop-2-enamide.
| Compound Name | (Z)-2-amino-3-(N-amino-3-chloro-2-fluoroanilino)-N-[5-(methylamino)-9-oxo-10-propan-2-yl-8,16,18-triazatricyclo[13.2.1.02,7]octadeca-1(17),2(7),3,5,15-pentaen-14-yl]prop-2-enamide |
|---|---|
| PubChem CID | 129199603 |
| Molecular Formula | C28H34ClFN8O2 |
| Molecular Weight | 569.09 g/mol |
| Exact Mass | 568.25 |
| IUPAC Name | (Z)-2-amino-3-(N-amino-3-chloro-2-fluoroanilino)-N-[5-(methylamino)-9-oxo-10-propan-2-yl-8,16,18-triazatricyclo[13.2.1.02,7]octadeca-1(17),2(7),3,5,15-pentaen-14-yl]prop-2-enamide |
| SMILES | CNc1ccc2c(c1)NC(=O)C(C(C)C)CCCC(NC(=O)/C(N)=C/N(N)c1cccc(Cl)c1F)c1ncc-2[nH]1 |
| InChI | InChI=1S/C28H34ClFN8O2/c1-15(2)17-6-4-8-21(36-28(40)20(31)14-38(32)24-9-5-7-19(29)25(24)30)26-34-13-23(35-26)18-11-10-16(33-3)12-22(18)37-27(17)39/h5,7,9-15,17,21,33H,4,6,8,31-32H2,1-3H3,(H,34,35)(H,36,40)(H,37,39)/b20-14- |
| InChIKey | JWFDZAGPOWWKOD-ZHZULCJRSA-N |
| XLogP | 4.64 |
| TPSA | 154.19 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.09 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|