About amino-(2-ethyl-1,2-dihydropyridin-5-yl)methanol
amino-(2-ethyl-1,2-dihydropyridin-5-yl)methanol (PubChem CID 129199789) has the molecular formula C8H14N2O
and a molecular weight of 154.21 g/mol. Its IUPAC name is amino-(2-ethyl-1,2-dihydropyridin-5-yl)methanol.
Molecular Properties
| Compound Name | amino-(2-ethyl-1,2-dihydropyridin-5-yl)methanol |
| PubChem CID | 129199789 |
| Molecular Formula | C8H14N2O |
| Molecular Weight | 154.21 g/mol |
| Exact Mass | 154.11 |
| IUPAC Name | amino-(2-ethyl-1,2-dihydropyridin-5-yl)methanol |
| SMILES | CCC1C=CC(C(N)O)=CN1 |
| InChI | InChI=1S/C8H14N2O/c1-2-7-4-3-6(5-10-7)8(9)11/h3-5,7-8,10-11H,2,9H2,1H3 |
| InChIKey | HGFZAEQOAXNQDR-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.21 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze amino-(2-ethyl-1,2-dihydropyridin-5-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of amino-(2-ethyl-1,2-dihydropyridin-5-yl)methanol?
The IUPAC name of amino-(2-ethyl-1,2-dihydropyridin-5-yl)methanol (CID 129199789) is amino-(2-ethyl-1,2-dihydropyridin-5-yl)methanol.
What is the SMILES notation for amino-(2-ethyl-1,2-dihydropyridin-5-yl)methanol?
The canonical SMILES for amino-(2-ethyl-1,2-dihydropyridin-5-yl)methanol is CCC1C=CC(C(N)O)=CN1.
What is the InChIKey of amino-(2-ethyl-1,2-dihydropyridin-5-yl)methanol?
The InChIKey is HGFZAEQOAXNQDR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N2O/c1-2-7-4-3-6(5-10-7)8(9)11/h3-5,7-8,10-11H,2,9H2,1H3.
What are the key properties of amino-(2-ethyl-1,2-dihydropyridin-5-yl)methanol?
amino-(2-ethyl-1,2-dihydropyridin-5-yl)methanol has a molecular weight of 154.21 g/mol, XLogP of 0.09, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for amino-(2-ethyl-1,2-dihydropyridin-5-yl)methanol is sourced from PubChem (CID 129199789), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).