C11H17N7S — CID 129199799
2-N-[(3R)-1-[(E)-N-(methylideneamino)-C-[(Z)-prop-1-enyl]carbonimidoyl]pyrrolidin-3-yl]-1,3,4-thiadiazole-2,5-diamine (PubChem CID 129199799) has the molecular formula C11H17N7S and a molecular weight of 279.37 g/mol. Its IUPAC name is 2-N-[(3R)-1-[(E)-N-(methylideneamino)-C-[(Z)-prop-1-enyl]carbonimidoyl]pyrrolidin-3-yl]-1,3,4-thiadiazole-2,5-diamine.
| Compound Name | 2-N-[(3R)-1-[(E)-N-(methylideneamino)-C-[(Z)-prop-1-enyl]carbonimidoyl]pyrrolidin-3-yl]-1,3,4-thiadiazole-2,5-diamine |
|---|---|
| PubChem CID | 129199799 |
| Molecular Formula | C11H17N7S |
| Molecular Weight | 279.37 g/mol |
| Exact Mass | 279.13 |
| IUPAC Name | 2-N-[(3R)-1-[(E)-N-(methylideneamino)-C-[(Z)-prop-1-enyl]carbonimidoyl]pyrrolidin-3-yl]-1,3,4-thiadiazole-2,5-diamine |
| SMILES | C=N/N=C(\C=C/C)N1CC[C@@H](Nc2nnc(N)s2)C1 |
| InChI | InChI=1S/C11H17N7S/c1-3-4-9(15-13-2)18-6-5-8(7-18)14-11-17-16-10(12)19-11/h3-4,8H,2,5-7H2,1H3,(H2,12,16)(H,14,17)/b4-3-,15-9+/t8-/m1/s1 |
| InChIKey | LRAJONRYGFAZBP-BGIXLQSXSA-N |
| XLogP | 1.20 |
| TPSA | 91.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.37 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|